C35H60BNO3 — CID 174075353
CID 174075353 (PubChem CID 174075353) has the molecular formula C35H60BNO3 and a molecular weight of 553.68 g/mol.
| Compound Name | CID 174075353 |
|---|---|
| PubChem CID | 174075353 |
| Molecular Formula | C35H60BNO3 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.47 |
| IUPAC Name | — |
| SMILES | [B]CCC(=O)CC1CCC(C)(C(C)C2OC(C=O)C3C2CCC2(C)C3CC[C@]2(C)[C@H](C)CCCC(C)C)N(C)C1 |
| InChI | InChI=1S/C35H60BNO3/c1-23(2)10-9-11-24(3)33(5)17-14-29-31-28(13-16-34(29,33)6)32(40-30(31)22-38)25(4)35(7)18-12-26(21-37(35)8)20-27(39)15-19-36/h22-26,28-32H,9-21H2,1-8H3/t24-,25?,26?,28?,29?,30?,31?,32?,33-,34?,35?/m1/s1 |
| InChIKey | ATRQBBYHHTXEPC-JOUFRLCHSA-N |
| XLogP | 7.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|