C11H14BrClN4O5P2 — CID 174101776
[[(5R)-5-(2-bromo-6-chloropurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphanyl]methylphosphonous acid (PubChem CID 174101776) has the molecular formula C11H14BrClN4O5P2 and a molecular weight of 459.56 g/mol. Its IUPAC name is [[(5R)-5-(2-bromo-6-chloropurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphanyl]methylphosphonous acid.
| Compound Name | [[(5R)-5-(2-bromo-6-chloropurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphanyl]methylphosphonous acid |
|---|---|
| PubChem CID | 174101776 |
| Molecular Formula | C11H14BrClN4O5P2 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | [[(5R)-5-(2-bromo-6-chloropurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphanyl]methylphosphonous acid |
| SMILES | OP(O)CP(O)OCC1CC[C@H](n2cnc3c(Cl)nc(Br)nc32)O1 |
| InChI | InChI=1S/C11H14BrClN4O5P2/c12-11-15-9(13)8-10(16-11)17(4-14-8)7-2-1-6(22-7)3-21-24(20)5-23(18)19/h4,6-7,18-20H,1-3,5H2/t6?,7-,24?/m1/s1 |
| InChIKey | BCFZTYZFGBMLOE-CIPGYVIBSA-N |
| XLogP | 2.49 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|