C18H17Cl2N3O2 — CID 11740365
5,7-dichloro-3-[(2S,5S)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]imidazo[4,5-b]pyridine (PubChem CID 11740365) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 5,7-dichloro-3-[(2S,5S)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]imidazo[4,5-b]pyridine.
| Compound Name | 5,7-dichloro-3-[(2S,5S)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 11740365 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 5,7-dichloro-3-[(2S,5S)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(OC[C@@H]2CC[C@@H](n3cnc4c(Cl)cc(Cl)nc43)O2)cc1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c1-11-2-4-12(5-3-11)24-9-13-6-7-16(25-13)23-10-21-17-14(19)8-15(20)22-18(17)23/h2-5,8,10,13,16H,6-7,9H2,1H3/t13-,16-/m0/s1 |
| InChIKey | OFJPFBXCVGEAMG-BBRMVZONSA-N |
| XLogP | 4.80 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|