C19H31NO4Si — CID 174115668
[(3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-methyloxolan-2-yl] pyridine-3-carboxylate (PubChem CID 174115668) has the molecular formula C19H31NO4Si and a molecular weight of 365.55 g/mol. Its IUPAC name is [(3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-methyloxolan-2-yl] pyridine-3-carboxylate.
| Compound Name | [(3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-methyloxolan-2-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 174115668 |
| Molecular Formula | C19H31NO4Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-4-methyloxolan-2-yl] pyridine-3-carboxylate |
| SMILES | CC[C@H]1OC(OC(=O)c2cccnc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C19H31NO4Si/c1-8-15-13(2)16(24-25(6,7)19(3,4)5)18(22-15)23-17(21)14-10-9-11-20-12-14/h9-13,15-16,18H,8H2,1-7H3/t13-,15-,16-,18?/m1/s1 |
| InChIKey | XYZYJMZBINDJMC-IPCZQBQASA-N |
| XLogP | 4.40 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|