About N-oxopropanimidamide
N-oxopropanimidamide (PubChem CID 174117199) has the molecular formula C3H6N2O
and a molecular weight of 86.09 g/mol. Its IUPAC name is N-oxopropanimidamide.
Molecular Properties
| Compound Name | N-oxopropanimidamide |
| PubChem CID | 174117199 |
| Molecular Formula | C3H6N2O |
| Molecular Weight | 86.09 g/mol |
| Exact Mass | 86.05 |
| IUPAC Name | N-oxopropanimidamide |
| SMILES | [H]/N=C(\CC)N=O |
| InChI | InChI=1S/C3H6N2O/c1-2-3(4)5-6/h4H,2H2,1H3/b4-3+ |
| InChIKey | NMPBGLBYRLUCEP-ONEGZZNKSA-N |
| XLogP | 1.14 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.09 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-oxopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxopropanimidamide?
The IUPAC name of N-oxopropanimidamide (CID 174117199) is N-oxopropanimidamide.
What is the SMILES notation for N-oxopropanimidamide?
The canonical SMILES for N-oxopropanimidamide is [H]/N=C(\CC)N=O.
What is the InChIKey of N-oxopropanimidamide?
The InChIKey is NMPBGLBYRLUCEP-ONEGZZNKSA-N. The full InChI is InChI=1S/C3H6N2O/c1-2-3(4)5-6/h4H,2H2,1H3/b4-3+.
What are the key properties of N-oxopropanimidamide?
N-oxopropanimidamide has a molecular weight of 86.09 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxopropanimidamide is sourced from PubChem (CID 174117199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).