C12H14F6O5 — CID 174178875
2-(3-methyl-2-oxobut-3-enoxy)propyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (PubChem CID 174178875) has the molecular formula C12H14F6O5 and a molecular weight of 352.23 g/mol. Its IUPAC name is 2-(3-methyl-2-oxobut-3-enoxy)propyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
| Compound Name | 2-(3-methyl-2-oxobut-3-enoxy)propyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 174178875 |
| Molecular Formula | C12H14F6O5 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-(3-methyl-2-oxobut-3-enoxy)propyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| SMILES | C=C(C)C(=O)COC(C)COC(=O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O5/c1-6(2)8(19)5-22-7(3)4-23-9(20)10(21,11(13,14)15)12(16,17)18/h7,21H,1,4-5H2,2-3H3 |
| InChIKey | VXYRYZDCOHHYIT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|