C28H25ClF5N5O5 — CID 174210435
[3-[[4-[5-chloro-2-[(3S)-5,5-difluoropiperidin-3-yl]oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate (PubChem CID 174210435) has the molecular formula C28H25ClF5N5O5 and a molecular weight of 641.98 g/mol. Its IUPAC name is [3-[[4-[5-chloro-2-[(3S)-5,5-difluoropiperidin-3-yl]oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[4-[5-chloro-2-[(3S)-5,5-difluoropiperidin-3-yl]oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174210435 |
| Molecular Formula | C28H25ClF5N5O5 |
| Molecular Weight | 641.98 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | [3-[[4-[5-chloro-2-[(3S)-5,5-difluoropiperidin-3-yl]oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C)(C)C5(OC(=O)C(F)(F)F)C4=O)cc23)c1O[C@@H]1CNCC(F)(F)C1 |
| InChI | InChI=1S/C28H25ClF5N5O5/c1-13-4-15(29)6-17(20(13)43-16-7-26(30,31)11-35-8-16)19-18-5-14(10-39(18)37-12-36-19)9-38-22(40)21-25(2,3)27(21,23(38)41)44-24(42)28(32,33)34/h4-6,10,12,16,21,35H,7-9,11H2,1-3H3/t16-,21?,27?/m0/s1 |
| InChIKey | HDYVGRBMYLTXPX-XQOPPPRMSA-N |
| XLogP | 4.10 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|