C26H52N2O11Si4 — CID 174223337
3-trimethoxysilylpropyl N-[1-[4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]-5-methoxy-2-nitrophenyl]ethyl]carbamate (PubChem CID 174223337) has the molecular formula C26H52N2O11Si4 and a molecular weight of 681.05 g/mol. Its IUPAC name is 3-trimethoxysilylpropyl N-[1-[4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]-5-methoxy-2-nitrophenyl]ethyl]carbamate.
| Compound Name | 3-trimethoxysilylpropyl N-[1-[4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]-5-methoxy-2-nitrophenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 174223337 |
| Molecular Formula | C26H52N2O11Si4 |
| Molecular Weight | 681.05 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | 3-trimethoxysilylpropyl N-[1-[4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]-5-methoxy-2-nitrophenyl]ethyl]carbamate |
| SMILES | COc1cc(C(C)NC(=O)OCCC[Si](OC)(OC)OC)c([N+](=O)[O-])cc1OCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H52N2O11Si4/c1-21(27-26(29)37-16-14-18-43(33-3,34-4)35-5)22-19-24(32-2)25(20-23(22)28(30)31)36-15-13-17-41(9,10)39-42(11,12)38-40(6,7)8/h19-21H,13-18H2,1-12H3,(H,27,29) |
| InChIKey | ZQYPJLOOTPBXBF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 146.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.05 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|