C48H36N6OS — CID 174257581
2-[3-(4,6-diphenyl-1,3,5-triazinan-2-yl)-4-phenoxathiin-1-ylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 174257581) has the molecular formula C48H36N6OS and a molecular weight of 744.92 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazinan-2-yl)-4-phenoxathiin-1-ylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazinan-2-yl)-4-phenoxathiin-1-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174257581 |
| Molecular Formula | C48H36N6OS |
| Molecular Weight | 744.92 g/mol |
| Exact Mass | 744.27 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazinan-2-yl)-4-phenoxathiin-1-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cccc5c4Sc4ccccc4O5)c(C4NC(c5ccccc5)NC(c5ccccc5)N4)c3)n2)cc1 |
| InChI | InChI=1S/C48H36N6OS/c1-5-16-31(17-6-1)43-49-44(32-18-7-2-8-19-32)52-47(51-43)35-28-29-36(37-24-15-26-40-42(37)56-41-27-14-13-25-39(41)55-40)38(30-35)48-53-45(33-20-9-3-10-21-33)50-46(54-48)34-22-11-4-12-23-34/h1-30,45-46,48,50,53-54H |
| InChIKey | VSNAMQVBIXTBIY-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.92 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |