C27H30FNO4 — CID 174263068
(15S)-24-fluoro-15-methylspiro[8-oxatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaene-17,5'-morpholine]-3',12-dione (PubChem CID 174263068) has the molecular formula C27H30FNO4 and a molecular weight of 451.54 g/mol. Its IUPAC name is (15S)-24-fluoro-15-methylspiro[8-oxatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaene-17,5'-morpholine]-3',12-dione.
| Compound Name | (15S)-24-fluoro-15-methylspiro[8-oxatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaene-17,5'-morpholine]-3',12-dione |
|---|---|
| PubChem CID | 174263068 |
| Molecular Formula | C27H30FNO4 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (15S)-24-fluoro-15-methylspiro[8-oxatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaene-17,5'-morpholine]-3',12-dione |
| SMILES | C[C@H]1CC2C(=O)CCCOc3ccccc3-c3cccc(c3F)CC2C2(COCC(=O)N2)C1 |
| InChI | InChI=1S/C27H30FNO4/c1-17-12-21-22(27(14-17)16-32-15-25(31)29-27)13-18-6-4-8-20(26(18)28)19-7-2-3-10-24(19)33-11-5-9-23(21)30/h2-4,6-8,10,17,21-22H,5,9,11-16H2,1H3,(H,29,31)/t17-,21?,22?,27?/m0/s1 |
| InChIKey | BQRPJIATHNYVCB-WMIHNSDKSA-N |
| XLogP | 4.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |