C24H28I2O6 — CID 174270932
2-O-butyl 3-O-[2,4-diiodo-6-[(2-methylpropan-2-yl)oxycarbonyl]phenyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 174270932) has the molecular formula C24H28I2O6 and a molecular weight of 666.29 g/mol. Its IUPAC name is 2-O-butyl 3-O-[2,4-diiodo-6-[(2-methylpropan-2-yl)oxycarbonyl]phenyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | 2-O-butyl 3-O-[2,4-diiodo-6-[(2-methylpropan-2-yl)oxycarbonyl]phenyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 174270932 |
| Molecular Formula | C24H28I2O6 |
| Molecular Weight | 666.29 g/mol |
| Exact Mass | 666.00 |
| IUPAC Name | 2-O-butyl 3-O-[2,4-diiodo-6-[(2-methylpropan-2-yl)oxycarbonyl]phenyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCCCOC(=O)C1C2C=CC(C2)C1C(=O)Oc1c(I)cc(I)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28I2O6/c1-5-6-9-30-22(28)18-13-7-8-14(10-13)19(18)23(29)31-20-16(11-15(25)12-17(20)26)21(27)32-24(2,3)4/h7-8,11-14,18-19H,5-6,9-10H2,1-4H3 |
| InChIKey | RLTIAXOQKGHLDY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.29 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|