C20H30N4O5Si — CID 174315495
tert-butyl 4-[4-[[(3S)-2,6-dioxo-3-silylpiperidin-3-yl]amino]-2-oxo-1-pyridinyl]piperidine-1-carboxylate (PubChem CID 174315495) has the molecular formula C20H30N4O5Si and a molecular weight of 434.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(3S)-2,6-dioxo-3-silylpiperidin-3-yl]amino]-2-oxo-1-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(3S)-2,6-dioxo-3-silylpiperidin-3-yl]amino]-2-oxo-1-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174315495 |
| Molecular Formula | C20H30N4O5Si |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | tert-butyl 4-[4-[[(3S)-2,6-dioxo-3-silylpiperidin-3-yl]amino]-2-oxo-1-pyridinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2ccc(N[C@]3([SiH3])CCC(=O)NC3=O)cc2=O)CC1 |
| InChI | InChI=1S/C20H30N4O5Si/c1-19(2,3)29-18(28)23-9-6-14(7-10-23)24-11-5-13(12-16(24)26)22-20(30)8-4-15(25)21-17(20)27/h5,11-12,14,22H,4,6-10H2,1-3,30H3,(H,21,25,27)/t20-/m0/s1 |
| InChIKey | WFWICMQXVWCGJP-FQEVSTJZSA-N |
| XLogP | 0.33 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|