C25H32N2O7 — CID 174344135
3-[2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylethyl)amino]butan-2-yl]-4-nitrobenzenecarboperoxoic acid (PubChem CID 174344135) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is 3-[2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylethyl)amino]butan-2-yl]-4-nitrobenzenecarboperoxoic acid.
| Compound Name | 3-[2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylethyl)amino]butan-2-yl]-4-nitrobenzenecarboperoxoic acid |
|---|---|
| PubChem CID | 174344135 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 3-[2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylethyl)amino]butan-2-yl]-4-nitrobenzenecarboperoxoic acid |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccccc1)CCC(C)(C)c1cc(C(=O)OO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H32N2O7/c1-24(2,3)33-23(29)26(15-13-18-9-7-6-8-10-18)16-14-25(4,5)20-17-19(22(28)34-32)11-12-21(20)27(30)31/h6-12,17,32H,13-16H2,1-5H3 |
| InChIKey | XWDADRGLGPHWGP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|