About 3-methyl-1-sulfinatooxybutane;nickel
3-methyl-1-sulfinatooxybutane;nickel (PubChem CID 174369100) has the molecular formula C5H11NiO3S-
and a molecular weight of 209.90 g/mol. Its IUPAC name is 3-methyl-1-sulfinatooxybutane;nickel.
Molecular Properties
| Compound Name | 3-methyl-1-sulfinatooxybutane;nickel |
| PubChem CID | 174369100 |
| Molecular Formula | C5H11NiO3S- |
| Molecular Weight | 209.90 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 3-methyl-1-sulfinatooxybutane;nickel |
| SMILES | CC(C)CCO[S-](=O)=O.[Ni] |
| InChI | InChI=1S/C5H11O3S.Ni/c1-5(2)3-4-8-9(6)7;/h5H,3-4H2,1-2H3;/q-1; |
| InChIKey | REXIJGXPMFXYHX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.90 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-sulfinatooxybutane;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-sulfinatooxybutane;nickel?
The IUPAC name of 3-methyl-1-sulfinatooxybutane;nickel (CID 174369100) is 3-methyl-1-sulfinatooxybutane;nickel.
What is the SMILES notation for 3-methyl-1-sulfinatooxybutane;nickel?
The canonical SMILES for 3-methyl-1-sulfinatooxybutane;nickel is CC(C)CCO[S-](=O)=O.[Ni].
What is the InChIKey of 3-methyl-1-sulfinatooxybutane;nickel?
The InChIKey is REXIJGXPMFXYHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O3S.Ni/c1-5(2)3-4-8-9(6)7;/h5H,3-4H2,1-2H3;/q-1;.
What are the key properties of 3-methyl-1-sulfinatooxybutane;nickel?
3-methyl-1-sulfinatooxybutane;nickel has a molecular weight of 209.90 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-sulfinatooxybutane;nickel is sourced from PubChem (CID 174369100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).