C17H17F3MgO6S — CID 174383373
magnesium 2-cyclopentyl-3-[[3-(trifluoromethylsulfonyl)phenyl]methyl]butanedioate (PubChem CID 174383373) has the molecular formula C17H17F3MgO6S and a molecular weight of 430.68 g/mol. Its IUPAC name is magnesium 2-cyclopentyl-3-[[3-(trifluoromethylsulfonyl)phenyl]methyl]butanedioate.
| Compound Name | magnesium 2-cyclopentyl-3-[[3-(trifluoromethylsulfonyl)phenyl]methyl]butanedioate |
|---|---|
| PubChem CID | 174383373 |
| Molecular Formula | C17H17F3MgO6S |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | magnesium 2-cyclopentyl-3-[[3-(trifluoromethylsulfonyl)phenyl]methyl]butanedioate |
| SMILES | O=C([O-])C(Cc1cccc(S(=O)(=O)C(F)(F)F)c1)C(C(=O)[O-])C1CCCC1.[Mg+2] |
| InChI | InChI=1S/C17H19F3O6S.Mg/c18-17(19,20)27(25,26)12-7-3-4-10(8-12)9-13(15(21)22)14(16(23)24)11-5-1-2-6-11;/h3-4,7-8,11,13-14H,1-2,5-6,9H2,(H,21,22)(H,23,24);/q;+2/p-2 |
| InChIKey | JWOKRDSPRNFHCT-UHFFFAOYSA-L |
| XLogP | 0.06 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |