C15H15F3N2O3S — CID 174389085
[4-[1-(oxolan-3-yl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methanesulfinic acid (PubChem CID 174389085) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is [4-[1-(oxolan-3-yl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[1-(oxolan-3-yl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174389085 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [4-[1-(oxolan-3-yl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(-c2cc(C(F)(F)F)nn2C2CCOC2)cc1 |
| InChI | InChI=1S/C15H15F3N2O3S/c16-15(17,18)14-7-13(20(19-14)12-5-6-23-8-12)11-3-1-10(2-4-11)9-24(21)22/h1-4,7,12H,5-6,8-9H2,(H,21,22) |
| InChIKey | QVCAHBNHRYUILE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|