About 2-chloroprop-1-ene;palladium
2-chloroprop-1-ene;palladium (PubChem CID 174390508) has the molecular formula C3H4ClPd-
and a molecular weight of 181.94 g/mol. Its IUPAC name is 2-chloroprop-1-ene;palladium.
Molecular Properties
| Compound Name | 2-chloroprop-1-ene;palladium |
| PubChem CID | 174390508 |
| Molecular Formula | C3H4ClPd- |
| Molecular Weight | 181.94 g/mol |
| Exact Mass | 180.90 |
| IUPAC Name | 2-chloroprop-1-ene;palladium |
| SMILES | C=C([CH2-])Cl.[Pd] |
| InChI | InChI=1S/C3H4Cl.Pd/c1-3(2)4;/h1-2H2;/q-1; |
| InChIKey | BUHXQULASSNOMK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.94 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroprop-1-ene;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroprop-1-ene;palladium?
The IUPAC name of 2-chloroprop-1-ene;palladium (CID 174390508) is 2-chloroprop-1-ene;palladium.
What is the SMILES notation for 2-chloroprop-1-ene;palladium?
The canonical SMILES for 2-chloroprop-1-ene;palladium is C=C([CH2-])Cl.[Pd].
What is the InChIKey of 2-chloroprop-1-ene;palladium?
The InChIKey is BUHXQULASSNOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4Cl.Pd/c1-3(2)4;/h1-2H2;/q-1;.
What are the key properties of 2-chloroprop-1-ene;palladium?
2-chloroprop-1-ene;palladium has a molecular weight of 181.94 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroprop-1-ene;palladium is sourced from PubChem (CID 174390508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).