About 2-methanidylphenol;palladium
2-methanidylphenol;palladium (PubChem CID 174392295) has the molecular formula C7H7OPd-
and a molecular weight of 213.55 g/mol. Its IUPAC name is 2-methanidylphenol;palladium.
Molecular Properties
| Compound Name | 2-methanidylphenol;palladium |
| PubChem CID | 174392295 |
| Molecular Formula | C7H7OPd- |
| Molecular Weight | 213.55 g/mol |
| Exact Mass | 212.95 |
| IUPAC Name | 2-methanidylphenol;palladium |
| SMILES | [CH2-]c1ccccc1O.[Pd] |
| InChI | InChI=1S/C7H7O.Pd/c1-6-4-2-3-5-7(6)8;/h2-5,8H,1H2;/q-1; |
| InChIKey | HHDRMKNMRXOPQP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylphenol;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylphenol;palladium?
The IUPAC name of 2-methanidylphenol;palladium (CID 174392295) is 2-methanidylphenol;palladium.
What is the SMILES notation for 2-methanidylphenol;palladium?
The canonical SMILES for 2-methanidylphenol;palladium is [CH2-]c1ccccc1O.[Pd].
What is the InChIKey of 2-methanidylphenol;palladium?
The InChIKey is HHDRMKNMRXOPQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O.Pd/c1-6-4-2-3-5-7(6)8;/h2-5,8H,1H2;/q-1;.
What are the key properties of 2-methanidylphenol;palladium?
2-methanidylphenol;palladium has a molecular weight of 213.55 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylphenol;palladium is sourced from PubChem (CID 174392295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).