C20H22FNO2S — CID 174393684
2-(4-acetyl-3-ethylidene-2-sulfanylidenepiperidin-1-yl)-1-cyclopropyl-2-(2-fluorophenyl)ethanone (PubChem CID 174393684) has the molecular formula C20H22FNO2S and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-(4-acetyl-3-ethylidene-2-sulfanylidenepiperidin-1-yl)-1-cyclopropyl-2-(2-fluorophenyl)ethanone.
| Compound Name | 2-(4-acetyl-3-ethylidene-2-sulfanylidenepiperidin-1-yl)-1-cyclopropyl-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 174393684 |
| Molecular Formula | C20H22FNO2S |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-(4-acetyl-3-ethylidene-2-sulfanylidenepiperidin-1-yl)-1-cyclopropyl-2-(2-fluorophenyl)ethanone |
| SMILES | CC=C1C(=S)N(C(C(=O)C2CC2)c2ccccc2F)CCC1C(C)=O |
| InChI | InChI=1S/C20H22FNO2S/c1-3-14-15(12(2)23)10-11-22(20(14)25)18(19(24)13-8-9-13)16-6-4-5-7-17(16)21/h3-7,13,15,18H,8-11H2,1-2H3 |
| InChIKey | UKAQYLASUQJNCG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|