C10H13NO2S — CID 174441365
5-benzyl-1,3-thiazolidine-2,4-diol (PubChem CID 174441365) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 5-benzyl-1,3-thiazolidine-2,4-diol.
| Compound Name | 5-benzyl-1,3-thiazolidine-2,4-diol |
|---|---|
| PubChem CID | 174441365 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 5-benzyl-1,3-thiazolidine-2,4-diol |
| SMILES | OC1NC(O)C(Cc2ccccc2)S1 |
| InChI | InChI=1S/C10H13NO2S/c12-9-8(14-10(13)11-9)6-7-4-2-1-3-5-7/h1-5,8-13H,6H2 |
| InChIKey | KGJMDQINZCLNGQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |