C19H36N2O2 — CID 174450091
1-ethyl-3-(2,2,5-triethyl-5-methylheptyl)imidazolidine-2,4-dione (PubChem CID 174450091) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-ethyl-3-(2,2,5-triethyl-5-methylheptyl)imidazolidine-2,4-dione.
| Compound Name | 1-ethyl-3-(2,2,5-triethyl-5-methylheptyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174450091 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1-ethyl-3-(2,2,5-triethyl-5-methylheptyl)imidazolidine-2,4-dione |
| SMILES | CCN1CC(=O)N(CC(CC)(CC)CCC(C)(CC)CC)C1=O |
| InChI | InChI=1S/C19H36N2O2/c1-7-18(6,8-2)12-13-19(9-3,10-4)15-21-16(22)14-20(11-5)17(21)23/h7-15H2,1-6H3 |
| InChIKey | MYXSKOGXSQQMMO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|