C30H54N4O5 — CID 69459287
3-[2,2-diethyl-6-[6-ethyl-4-(3-ethyl-2,5-dioxoimidazolidin-1-yl)octan-2-yl]oxyhexyl]-1-ethylimidazolidine-2,4-dione (PubChem CID 69459287) has the molecular formula C30H54N4O5 and a molecular weight of 550.79 g/mol. Its IUPAC name is 3-[2,2-diethyl-6-[6-ethyl-4-(3-ethyl-2,5-dioxoimidazolidin-1-yl)octan-2-yl]oxyhexyl]-1-ethylimidazolidine-2,4-dione.
| Compound Name | 3-[2,2-diethyl-6-[6-ethyl-4-(3-ethyl-2,5-dioxoimidazolidin-1-yl)octan-2-yl]oxyhexyl]-1-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69459287 |
| Molecular Formula | C30H54N4O5 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.41 |
| IUPAC Name | 3-[2,2-diethyl-6-[6-ethyl-4-(3-ethyl-2,5-dioxoimidazolidin-1-yl)octan-2-yl]oxyhexyl]-1-ethylimidazolidine-2,4-dione |
| SMILES | CCC(CC)CC(CC(C)OCCCCC(CC)(CC)CN1C(=O)CN(CC)C1=O)N1C(=O)CN(CC)C1=O |
| InChI | InChI=1S/C30H54N4O5/c1-8-24(9-2)19-25(34-27(36)21-32(13-6)29(34)38)18-23(7)39-17-15-14-16-30(10-3,11-4)22-33-26(35)20-31(12-5)28(33)37/h23-25H,8-22H2,1-7H3 |
| InChIKey | CUBGJOTWFNAQFH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|