C11H13N5O4P+ — CID 174450491
2-[1-[(2-amino-6-oxo-1H-purin-9-yl)methyl]cyclopropyl]ethenoxy-hydroxy-oxophosphanium (PubChem CID 174450491) has the molecular formula C11H13N5O4P+ and a molecular weight of 310.23 g/mol. Its IUPAC name is 2-[1-[(2-amino-6-oxo-1H-purin-9-yl)methyl]cyclopropyl]ethenoxy-hydroxy-oxophosphanium.
| Compound Name | 2-[1-[(2-amino-6-oxo-1H-purin-9-yl)methyl]cyclopropyl]ethenoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174450491 |
| Molecular Formula | C11H13N5O4P+ |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[1-[(2-amino-6-oxo-1H-purin-9-yl)methyl]cyclopropyl]ethenoxy-hydroxy-oxophosphanium |
| SMILES | Nc1nc2c(ncn2CC2(C=CO[P+](=O)O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H12N5O4P/c12-10-14-8-7(9(17)15-10)13-6-16(8)5-11(1-2-11)3-4-20-21(18)19/h3-4,6H,1-2,5H2,(H3-,12,14,15,17,18,19)/p+1 |
| InChIKey | VWCIERQPNKOGKT-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|