About cobalt;pentane-2,4-dione;titanium
cobalt;pentane-2,4-dione;titanium (PubChem CID 174458762) has the molecular formula C5H7CoO2Ti-
and a molecular weight of 205.91 g/mol. Its IUPAC name is cobalt;pentane-2,4-dione;titanium.
Molecular Properties
| Compound Name | cobalt;pentane-2,4-dione;titanium |
| PubChem CID | 174458762 |
| Molecular Formula | C5H7CoO2Ti- |
| Molecular Weight | 205.91 g/mol |
| Exact Mass | 205.93 |
| IUPAC Name | cobalt;pentane-2,4-dione;titanium |
| SMILES | [CH2-]C(=O)CC(C)=O.[Co].[Ti] |
| InChI | InChI=1S/C5H7O2.Co.Ti/c1-4(6)3-5(2)7;;/h1,3H2,2H3;;/q-1;; |
| InChIKey | AEENYPZQYBCMSA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.91 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;pentane-2,4-dione;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;pentane-2,4-dione;titanium?
The IUPAC name of cobalt;pentane-2,4-dione;titanium (CID 174458762) is cobalt;pentane-2,4-dione;titanium.
What is the SMILES notation for cobalt;pentane-2,4-dione;titanium?
The canonical SMILES for cobalt;pentane-2,4-dione;titanium is [CH2-]C(=O)CC(C)=O.[Co].[Ti].
What is the InChIKey of cobalt;pentane-2,4-dione;titanium?
The InChIKey is AEENYPZQYBCMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7O2.Co.Ti/c1-4(6)3-5(2)7;;/h1,3H2,2H3;;/q-1;;.
What are the key properties of cobalt;pentane-2,4-dione;titanium?
cobalt;pentane-2,4-dione;titanium has a molecular weight of 205.91 g/mol, XLogP of 0.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;pentane-2,4-dione;titanium is sourced from PubChem (CID 174458762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).