About pentane-2,4-dione;tungsten
pentane-2,4-dione;tungsten (PubChem CID 58916144) has the molecular formula C5H7O2W-
and a molecular weight of 282.95 g/mol. Its IUPAC name is pentane-2,4-dione;tungsten.
Molecular Properties
| Compound Name | pentane-2,4-dione;tungsten |
| PubChem CID | 58916144 |
| Molecular Formula | C5H7O2W- |
| Molecular Weight | 282.95 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | pentane-2,4-dione;tungsten |
| SMILES | [CH2-]C(=O)CC(C)=O.[W] |
| InChI | InChI=1S/C5H7O2.W/c1-4(6)3-5(2)7;/h1,3H2,2H3;/q-1; |
| InChIKey | YMNLDIUAAHWANG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.95 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze pentane-2,4-dione;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-2,4-dione;tungsten?
The IUPAC name of pentane-2,4-dione;tungsten (CID 58916144) is pentane-2,4-dione;tungsten.
What is the SMILES notation for pentane-2,4-dione;tungsten?
The canonical SMILES for pentane-2,4-dione;tungsten is [CH2-]C(=O)CC(C)=O.[W].
What is the InChIKey of pentane-2,4-dione;tungsten?
The InChIKey is YMNLDIUAAHWANG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7O2.W/c1-4(6)3-5(2)7;/h1,3H2,2H3;/q-1;.
What are the key properties of pentane-2,4-dione;tungsten?
pentane-2,4-dione;tungsten has a molecular weight of 282.95 g/mol, XLogP of 0.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-2,4-dione;tungsten is sourced from PubChem (CID 58916144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).