C11H23O4Ti- — CID 174827284
pentane-2,4-dione;bis(propan-1-ol);titanium (PubChem CID 174827284) has the molecular formula C11H23O4Ti- and a molecular weight of 267.17 g/mol. Its IUPAC name is pentane-2,4-dione;bis(propan-1-ol);titanium.
| Compound Name | pentane-2,4-dione;bis(propan-1-ol);titanium |
|---|---|
| PubChem CID | 174827284 |
| Molecular Formula | C11H23O4Ti- |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | pentane-2,4-dione;bis(propan-1-ol);titanium |
| SMILES | CCCO.CCCO.[CH2-]C(=O)CC(C)=O.[Ti] |
| InChI | InChI=1S/C5H7O2.2C3H8O.Ti/c1-4(6)3-5(2)7;2*1-2-3-4;/h1,3H2,2H3;2*4H,2-3H2,1H3;/q-1;;; |
| InChIKey | IPRFNPCJWWZDBA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|