C10H13ClN4O5 — CID 174474031
4-[(2-chloro-4-nitroimidazol-1-yl)methyl]-4-hydroxypiperidine-1-carboxylic acid (PubChem CID 174474031) has the molecular formula C10H13ClN4O5 and a molecular weight of 304.69 g/mol. Its IUPAC name is 4-[(2-chloro-4-nitroimidazol-1-yl)methyl]-4-hydroxypiperidine-1-carboxylic acid.
| Compound Name | 4-[(2-chloro-4-nitroimidazol-1-yl)methyl]-4-hydroxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174474031 |
| Molecular Formula | C10H13ClN4O5 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-[(2-chloro-4-nitroimidazol-1-yl)methyl]-4-hydroxypiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(O)(Cn2cc([N+](=O)[O-])nc2Cl)CC1 |
| InChI | InChI=1S/C10H13ClN4O5/c11-8-12-7(15(19)20)5-14(8)6-10(18)1-3-13(4-2-10)9(16)17/h5,18H,1-4,6H2,(H,16,17) |
| InChIKey | YEZILRGTILLIDS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|