C5H5ClN2S — CID 174498962
1H-thieno[2,3-d]pyrazole;hydrochloride (PubChem CID 174498962) has the molecular formula C5H5ClN2S and a molecular weight of 160.63 g/mol. Its IUPAC name is 1H-thieno[2,3-d]pyrazole;hydrochloride.
| Compound Name | 1H-thieno[2,3-d]pyrazole;hydrochloride |
|---|---|
| PubChem CID | 174498962 |
| Molecular Formula | C5H5ClN2S |
| Molecular Weight | 160.63 g/mol |
| Exact Mass | 159.99 |
| IUPAC Name | 1H-thieno[2,3-d]pyrazole;hydrochloride |
| SMILES | Cl.c1cc2[nH]ncc2s1 |
| InChI | InChI=1S/C5H4N2S.ClH/c1-2-8-5-3-6-7-4(1)5;/h1-3H,(H,6,7);1H |
| InChIKey | CBUPXILLQSNNEX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.63 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |