C20H24O3 — CID 174567840
1-[3-(oxiran-2-ylmethoxy)propyl]-4-(2-phenylethenyl)cyclohexa-2,4-dien-1-ol (PubChem CID 174567840) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[3-(oxiran-2-ylmethoxy)propyl]-4-(2-phenylethenyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1-[3-(oxiran-2-ylmethoxy)propyl]-4-(2-phenylethenyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 174567840 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[3-(oxiran-2-ylmethoxy)propyl]-4-(2-phenylethenyl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1(CCCOCC2CO2)C=CC(C=Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C20H24O3/c21-20(11-4-14-22-15-19-16-23-19)12-9-18(10-13-20)8-7-17-5-2-1-3-6-17/h1-3,5-10,12,19,21H,4,11,13-16H2 |
| InChIKey | MHSRJYDGLVKKIV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|