C28H28N4 — CID 174573297
7,8-dimethyl-1,2,11,12-tetrahydrochrysene;quinazoline-2,4-diamine (PubChem CID 174573297) has the molecular formula C28H28N4 and a molecular weight of 420.56 g/mol. Its IUPAC name is 7,8-dimethyl-1,2,11,12-tetrahydrochrysene;quinazoline-2,4-diamine.
| Compound Name | 7,8-dimethyl-1,2,11,12-tetrahydrochrysene;quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 174573297 |
| Molecular Formula | C28H28N4 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 7,8-dimethyl-1,2,11,12-tetrahydrochrysene;quinazoline-2,4-diamine |
| SMILES | Cc1ccc2c3c(ccc2c1C)C1=C(CCC=C1)CC3.Nc1nc(N)c2ccccc2n1 |
| InChI | InChI=1S/C20H20.C8H8N4/c1-13-7-9-18-16(14(13)2)11-12-19-17-6-4-3-5-15(17)8-10-20(18)19;9-7-5-3-1-2-4-6(5)11-8(10)12-7/h4,6-7,9,11-12H,3,5,8,10H2,1-2H3;1-4H,(H4,9,10,11,12) |
| InChIKey | TWAUGMHNUJXUQR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |