C16H23NO2 — CID 174583558
N-[(1S)-1-ethenylcyclohexa-2,4-dien-1-yl]-2,2-dimethyl-N-propanoylpropanamide (PubChem CID 174583558) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-[(1S)-1-ethenylcyclohexa-2,4-dien-1-yl]-2,2-dimethyl-N-propanoylpropanamide.
| Compound Name | N-[(1S)-1-ethenylcyclohexa-2,4-dien-1-yl]-2,2-dimethyl-N-propanoylpropanamide |
|---|---|
| PubChem CID | 174583558 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[(1S)-1-ethenylcyclohexa-2,4-dien-1-yl]-2,2-dimethyl-N-propanoylpropanamide |
| SMILES | C=C[C@]1(N(C(=O)CC)C(=O)C(C)(C)C)C=CC=CC1 |
| InChI | InChI=1S/C16H23NO2/c1-6-13(18)17(14(19)15(3,4)5)16(7-2)11-9-8-10-12-16/h7-11H,2,6,12H2,1,3-5H3/t16-/m0/s1 |
| InChIKey | WIPRZRYQQWALOU-INIZCTEOSA-N |
| XLogP | 3.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|