C34H36N2O4 — CID 174584465
5-(2-methylprop-2-enoyloxy)pentyl naphthalene-1-carboxylate;5-(2-phenylethenyl)benzene-1,3-diamine (PubChem CID 174584465) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoyloxy)pentyl naphthalene-1-carboxylate;5-(2-phenylethenyl)benzene-1,3-diamine.
| Compound Name | 5-(2-methylprop-2-enoyloxy)pentyl naphthalene-1-carboxylate;5-(2-phenylethenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 174584465 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 5-(2-methylprop-2-enoyloxy)pentyl naphthalene-1-carboxylate;5-(2-phenylethenyl)benzene-1,3-diamine |
| SMILES | C=C(C)C(=O)OCCCCCOC(=O)c1cccc2ccccc12.Nc1cc(N)cc(C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H22O4.C14H14N2/c1-15(2)19(21)23-13-6-3-7-14-24-20(22)18-12-8-10-16-9-4-5-11-17(16)18;15-13-8-12(9-14(16)10-13)7-6-11-4-2-1-3-5-11/h4-5,8-12H,1,3,6-7,13-14H2,2H3;1-10H,15-16H2 |
| InChIKey | XXLOLGFNYCWPSZ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|