C5H15N3O — CID 174585201
1-N'-methoxybutane-1,1,4-triamine (PubChem CID 174585201) has the molecular formula C5H15N3O and a molecular weight of 133.19 g/mol. Its IUPAC name is 1-N'-methoxybutane-1,1,4-triamine.
| Compound Name | 1-N'-methoxybutane-1,1,4-triamine |
|---|---|
| PubChem CID | 174585201 |
| Molecular Formula | C5H15N3O |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.12 |
| IUPAC Name | 1-N'-methoxybutane-1,1,4-triamine |
| SMILES | CONC(N)CCCN |
| InChI | InChI=1S/C5H15N3O/c1-9-8-5(7)3-2-4-6/h5,8H,2-4,6-7H2,1H3 |
| InChIKey | LITZPFRRWOYIAI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|