C13H10ClFNO2S- — CID 174587193
2-chloro-4-fluoro-1-(4-methyl-N-sulfinatoanilino)benzene (PubChem CID 174587193) has the molecular formula C13H10ClFNO2S- and a molecular weight of 298.75 g/mol. Its IUPAC name is 2-chloro-4-fluoro-1-(4-methyl-N-sulfinatoanilino)benzene.
| Compound Name | 2-chloro-4-fluoro-1-(4-methyl-N-sulfinatoanilino)benzene |
|---|---|
| PubChem CID | 174587193 |
| Molecular Formula | C13H10ClFNO2S- |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-chloro-4-fluoro-1-(4-methyl-N-sulfinatoanilino)benzene |
| SMILES | Cc1ccc(N(c2ccc(F)cc2Cl)S(=O)[O-])cc1 |
| InChI | InChI=1S/C13H11ClFNO2S/c1-9-2-5-11(6-3-9)16(19(17)18)13-7-4-10(15)8-12(13)14/h2-8H,1H3,(H,17,18)/p-1 |
| InChIKey | BTZRTLHZYWCJHH-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|