C10H10I3NO — CID 174608066
2-methylprop-2-enamide;1,3,5-triiodobenzene (PubChem CID 174608066) has the molecular formula C10H10I3NO and a molecular weight of 540.91 g/mol. Its IUPAC name is 2-methylprop-2-enamide;1,3,5-triiodobenzene.
| Compound Name | 2-methylprop-2-enamide;1,3,5-triiodobenzene |
|---|---|
| PubChem CID | 174608066 |
| Molecular Formula | C10H10I3NO |
| Molecular Weight | 540.91 g/mol |
| Exact Mass | 540.79 |
| IUPAC Name | 2-methylprop-2-enamide;1,3,5-triiodobenzene |
| SMILES | C=C(C)C(N)=O.Ic1cc(I)cc(I)c1 |
| InChI | InChI=1S/C6H3I3.C4H7NO/c7-4-1-5(8)3-6(9)2-4;1-3(2)4(5)6/h1-3H;1H2,2H3,(H2,5,6) |
| InChIKey | NMPJVSGPMJSGMI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.91 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|