C14H17NO — CID 174651574
3-hex-1-enyl-2,3-dihydroisoindol-1-one (PubChem CID 174651574) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-hex-1-enyl-2,3-dihydroisoindol-1-one.
| Compound Name | 3-hex-1-enyl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 174651574 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-hex-1-enyl-2,3-dihydroisoindol-1-one |
| SMILES | CCCCC=CC1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C14H17NO/c1-2-3-4-5-10-13-11-8-6-7-9-12(11)14(16)15-13/h5-10,13H,2-4H2,1H3,(H,15,16) |
| InChIKey | WIQIGHSRWBZFPK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|