C21H26N2O5 — CID 174681345
2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid;(2S)-pyrrolidine-2-carboxamide (PubChem CID 174681345) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid;(2S)-pyrrolidine-2-carboxamide.
| Compound Name | 2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid;(2S)-pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174681345 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid;(2S)-pyrrolidine-2-carboxamide |
| SMILES | COC(c1ccccc1)(c1ccccc1)C(O)C(=O)O.NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C16H16O4.C5H10N2O/c1-20-16(14(17)15(18)19,12-8-4-2-5-9-12)13-10-6-3-7-11-13;6-5(8)4-2-1-3-7-4/h2-11,14,17H,1H3,(H,18,19);4,7H,1-3H2,(H2,6,8)/t;4-/m.0/s1 |
| InChIKey | CUSJOYQSLVDVNI-VWMHFEHESA-N |
| XLogP | 1.25 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |