C19H15NO5 — CID 17470387
(4Z)-2-(1,3-benzodioxol-5-yl)-4-[[5-(2-methylcyclopropyl)furan-2-yl]methylidene]-1,3-oxazol-5-one (PubChem CID 17470387) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is (4Z)-2-(1,3-benzodioxol-5-yl)-4-[[5-(2-methylcyclopropyl)furan-2-yl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-[[5-(2-methylcyclopropyl)furan-2-yl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 17470387 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-[[5-(2-methylcyclopropyl)furan-2-yl]methylidene]-1,3-oxazol-5-one |
| SMILES | CC1CC1c1ccc(/C=C2\N=C(c3ccc4c(c3)OCO4)OC2=O)o1 |
| InChI | InChI=1S/C19H15NO5/c1-10-6-13(10)15-5-3-12(24-15)8-14-19(21)25-18(20-14)11-2-4-16-17(7-11)23-9-22-16/h2-5,7-8,10,13H,6,9H2,1H3/b14-8- |
| InChIKey | XDDDYXBNCWUTMT-ZSOIEALJSA-N |
| XLogP | 3.48 |
| TPSA | 70.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|