C13H16O — CID 174721958
5-(3,5-dimethylphenyl)-3,6-dihydro-2H-pyran (PubChem CID 174721958) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 5-(3,5-dimethylphenyl)-3,6-dihydro-2H-pyran.
| Compound Name | 5-(3,5-dimethylphenyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 174721958 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 5-(3,5-dimethylphenyl)-3,6-dihydro-2H-pyran |
| SMILES | Cc1cc(C)cc(C2=CCCOC2)c1 |
| InChI | InChI=1S/C13H16O/c1-10-6-11(2)8-13(7-10)12-4-3-5-14-9-12/h4,6-8H,3,5,9H2,1-2H3 |
| InChIKey | HEXLLSZCSZQSTN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |