C8H6CuF6O3 — CID 174742988
copper;fluoro 4,4,5,5,5-pentafluoro-3-oxo-2-propan-2-ylidenepentanoate (PubChem CID 174742988) has the molecular formula C8H6CuF6O3 and a molecular weight of 327.67 g/mol. Its IUPAC name is copper;fluoro 4,4,5,5,5-pentafluoro-3-oxo-2-propan-2-ylidenepentanoate.
| Compound Name | copper;fluoro 4,4,5,5,5-pentafluoro-3-oxo-2-propan-2-ylidenepentanoate |
|---|---|
| PubChem CID | 174742988 |
| Molecular Formula | C8H6CuF6O3 |
| Molecular Weight | 327.67 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | copper;fluoro 4,4,5,5,5-pentafluoro-3-oxo-2-propan-2-ylidenepentanoate |
| SMILES | CC(C)=C(C(=O)OF)C(=O)C(F)(F)C(F)(F)F.[Cu] |
| InChI | InChI=1S/C8H6F6O3.Cu/c1-3(2)4(6(16)17-14)5(15)7(9,10)8(11,12)13;/h1-2H3; |
| InChIKey | DERGTQJSRFPPAX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|