About (3-methoxyphenyl) propaneperoxoate
(3-methoxyphenyl) propaneperoxoate (PubChem CID 174743709) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is (3-methoxyphenyl) propaneperoxoate.
Molecular Properties
| Compound Name | (3-methoxyphenyl) propaneperoxoate |
| PubChem CID | 174743709 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3-methoxyphenyl) propaneperoxoate |
| SMILES | CCC(=O)OOc1cccc(OC)c1 |
| InChI | InChI=1S/C10H12O4/c1-3-10(11)14-13-9-6-4-5-8(7-9)12-2/h4-7H,3H2,1-2H3 |
| InChIKey | YYANPBIFLJDKCI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxyphenyl) propaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl) propaneperoxoate?
The IUPAC name of (3-methoxyphenyl) propaneperoxoate (CID 174743709) is (3-methoxyphenyl) propaneperoxoate.
What is the SMILES notation for (3-methoxyphenyl) propaneperoxoate?
The canonical SMILES for (3-methoxyphenyl) propaneperoxoate is CCC(=O)OOc1cccc(OC)c1.
What is the InChIKey of (3-methoxyphenyl) propaneperoxoate?
The InChIKey is YYANPBIFLJDKCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-3-10(11)14-13-9-6-4-5-8(7-9)12-2/h4-7H,3H2,1-2H3.
What are the key properties of (3-methoxyphenyl) propaneperoxoate?
(3-methoxyphenyl) propaneperoxoate has a molecular weight of 196.20 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl) propaneperoxoate is sourced from PubChem (CID 174743709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).