About carbamimidoyl iodide;tetrachloroplumbane
carbamimidoyl iodide;tetrachloroplumbane (PubChem CID 174746139) has the molecular formula CH3Cl4IN2Pb
and a molecular weight of 518.97 g/mol. Its IUPAC name is carbamimidoyl iodide;tetrachloroplumbane.
Molecular Properties
| Compound Name | carbamimidoyl iodide;tetrachloroplumbane |
| PubChem CID | 174746139 |
| Molecular Formula | CH3Cl4IN2Pb |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 517.79 |
| IUPAC Name | carbamimidoyl iodide;tetrachloroplumbane |
| SMILES | Cl[Pb](Cl)(Cl)Cl.[H]/N=C(/N)I |
| InChI | InChI=1S/CH3IN2.4ClH.Pb/c2-1(3)4;;;;;/h(H3,3,4);4*1H;/q;;;;;+4/p-4 |
| InChIKey | DQTCMPOBFRJXFO-UHFFFAOYSA-J |
| XLogP | 2.69 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze carbamimidoyl iodide;tetrachloroplumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamimidoyl iodide;tetrachloroplumbane?
The IUPAC name of carbamimidoyl iodide;tetrachloroplumbane (CID 174746139) is carbamimidoyl iodide;tetrachloroplumbane.
What is the SMILES notation for carbamimidoyl iodide;tetrachloroplumbane?
The canonical SMILES for carbamimidoyl iodide;tetrachloroplumbane is Cl[Pb](Cl)(Cl)Cl.[H]/N=C(/N)I.
What is the InChIKey of carbamimidoyl iodide;tetrachloroplumbane?
The InChIKey is DQTCMPOBFRJXFO-UHFFFAOYSA-J. The full InChI is InChI=1S/CH3IN2.4ClH.Pb/c2-1(3)4;;;;;/h(H3,3,4);4*1H;/q;;;;;+4/p-4.
What are the key properties of carbamimidoyl iodide;tetrachloroplumbane?
carbamimidoyl iodide;tetrachloroplumbane has a molecular weight of 518.97 g/mol, XLogP of 2.69, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamimidoyl iodide;tetrachloroplumbane is sourced from PubChem (CID 174746139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).