C31H35ClN4 — CID 174749807
[2-[3-[2,6-di(propan-2-yl)phenyl]imidazol-3-ium-1-yl]phenyl]methanamine;quinoline;chloride (PubChem CID 174749807) has the molecular formula C31H35ClN4 and a molecular weight of 499.10 g/mol. Its IUPAC name is [2-[3-[2,6-di(propan-2-yl)phenyl]imidazol-3-ium-1-yl]phenyl]methanamine;quinoline;chloride.
| Compound Name | [2-[3-[2,6-di(propan-2-yl)phenyl]imidazol-3-ium-1-yl]phenyl]methanamine;quinoline;chloride |
|---|---|
| PubChem CID | 174749807 |
| Molecular Formula | C31H35ClN4 |
| Molecular Weight | 499.10 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [2-[3-[2,6-di(propan-2-yl)phenyl]imidazol-3-ium-1-yl]phenyl]methanamine;quinoline;chloride |
| SMILES | CC(C)c1cccc(C(C)C)c1-[n+]1ccn(-c2ccccc2CN)c1.[Cl-].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C22H28N3.C9H7N.ClH/c1-16(2)19-9-7-10-20(17(3)4)22(19)25-13-12-24(15-25)21-11-6-5-8-18(21)14-23;1-2-6-9-8(4-1)5-3-7-10-9;/h5-13,15-17H,14,23H2,1-4H3;1-7H;1H/q+1;;/p-1 |
| InChIKey | VNBLCMSBNCZIEY-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|