C23H28 — CID 174762546
4-(4-butylphenyl)-2,5,6,7-tetramethyl-1H-indene (PubChem CID 174762546) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-(4-butylphenyl)-2,5,6,7-tetramethyl-1H-indene.
| Compound Name | 4-(4-butylphenyl)-2,5,6,7-tetramethyl-1H-indene |
|---|---|
| PubChem CID | 174762546 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 4-(4-butylphenyl)-2,5,6,7-tetramethyl-1H-indene |
| SMILES | CCCCc1ccc(-c2c(C)c(C)c(C)c3c2C=C(C)C3)cc1 |
| InChI | InChI=1S/C23H28/c1-6-7-8-19-9-11-20(12-10-19)23-18(5)16(3)17(4)21-13-15(2)14-22(21)23/h9-12,14H,6-8,13H2,1-5H3 |
| InChIKey | QQHCDBMUVTVUHA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |