C22H34N2O5 — CID 174783276
benzyl formate;tert-butyl 5-[(3S)-3-methyl-2-oxopiperazin-1-yl]pentanoate (PubChem CID 174783276) has the molecular formula C22H34N2O5 and a molecular weight of 406.52 g/mol. Its IUPAC name is benzyl formate;tert-butyl 5-[(3S)-3-methyl-2-oxopiperazin-1-yl]pentanoate.
| Compound Name | benzyl formate;tert-butyl 5-[(3S)-3-methyl-2-oxopiperazin-1-yl]pentanoate |
|---|---|
| PubChem CID | 174783276 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | benzyl formate;tert-butyl 5-[(3S)-3-methyl-2-oxopiperazin-1-yl]pentanoate |
| SMILES | C[C@@H]1NCCN(CCCCC(=O)OC(C)(C)C)C1=O.O=COCc1ccccc1 |
| InChI | InChI=1S/C14H26N2O3.C8H8O2/c1-11-13(18)16(10-8-15-11)9-6-5-7-12(17)19-14(2,3)4;9-7-10-6-8-4-2-1-3-5-8/h11,15H,5-10H2,1-4H3;1-5,7H,6H2/t11-;/m0./s1 |
| InChIKey | GNVVAGBWCDMFNN-MERQFXBCSA-N |
| XLogP | 2.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|