C13H18O7 — CID 174825638
3-hydroxypropyl 3-hydroxy-2-methyl-4-oxohexa-2,5-dienoate;prop-2-enoic acid (PubChem CID 174825638) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is 3-hydroxypropyl 3-hydroxy-2-methyl-4-oxohexa-2,5-dienoate;prop-2-enoic acid.
| Compound Name | 3-hydroxypropyl 3-hydroxy-2-methyl-4-oxohexa-2,5-dienoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 174825638 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-hydroxypropyl 3-hydroxy-2-methyl-4-oxohexa-2,5-dienoate;prop-2-enoic acid |
| SMILES | C=CC(=O)C(O)=C(C)C(=O)OCCCO.C=CC(=O)O |
| InChI | InChI=1S/C10H14O5.C3H4O2/c1-3-8(12)9(13)7(2)10(14)15-6-4-5-11;1-2-3(4)5/h3,11,13H,1,4-6H2,2H3;2H,1H2,(H,4,5) |
| InChIKey | HHXXVJPQLAMYSB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|