C15H21BCl2O4 — CID 174827759
2-(2,6-dichloro-3,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane (PubChem CID 174827759) has the molecular formula C15H21BCl2O4 and a molecular weight of 347.05 g/mol. Its IUPAC name is 2-(2,6-dichloro-3,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(2,6-dichloro-3,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 174827759 |
| Molecular Formula | C15H21BCl2O4 |
| Molecular Weight | 347.05 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-(2,6-dichloro-3,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane |
| SMILES | COc1cc(OC)c(Cl)c(B2OCC(C)(C)C(C)(C)O2)c1Cl |
| InChI | InChI=1S/C15H21BCl2O4/c1-14(2)8-21-16(22-15(14,3)4)11-12(17)9(19-5)7-10(20-6)13(11)18/h7H,8H2,1-6H3 |
| InChIKey | AMLMEWQQGMBKCD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.05 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|