About bis(2-methylpropyl)alumanylium;hydride;2-methylaniline
bis(2-methylpropyl)alumanylium;hydride;2-methylaniline (PubChem CID 174831782) has the molecular formula C15H28AlN
and a molecular weight of 249.38 g/mol. Its IUPAC name is bis(2-methylpropyl)alumanylium;hydride;2-methylaniline.
Molecular Properties
| Compound Name | bis(2-methylpropyl)alumanylium;hydride;2-methylaniline |
| PubChem CID | 174831782 |
| Molecular Formula | C15H28AlN |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | bis(2-methylpropyl)alumanylium;hydride;2-methylaniline |
| SMILES | CC(C)C[Al+]CC(C)C.Cc1ccccc1N.[H-] |
| InChI | InChI=1S/C7H9N.2C4H9.Al.H/c1-6-4-2-3-5-7(6)8;2*1-4(2)3;;/h2-5H,8H2,1H3;2*4H,1H2,2-3H3;;/q;;;+1;-1 |
| InChIKey | CAZSVSKTDGRODP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropyl)alumanylium;hydride;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl)alumanylium;hydride;2-methylaniline?
The IUPAC name of bis(2-methylpropyl)alumanylium;hydride;2-methylaniline (CID 174831782) is bis(2-methylpropyl)alumanylium;hydride;2-methylaniline.
What is the SMILES notation for bis(2-methylpropyl)alumanylium;hydride;2-methylaniline?
The canonical SMILES for bis(2-methylpropyl)alumanylium;hydride;2-methylaniline is CC(C)C[Al+]CC(C)C.Cc1ccccc1N.[H-].
What is the InChIKey of bis(2-methylpropyl)alumanylium;hydride;2-methylaniline?
The InChIKey is CAZSVSKTDGRODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.2C4H9.Al.H/c1-6-4-2-3-5-7(6)8;2*1-4(2)3;;/h2-5H,8H2,1H3;2*4H,1H2,2-3H3;;/q;;;+1;-1.
What are the key properties of bis(2-methylpropyl)alumanylium;hydride;2-methylaniline?
bis(2-methylpropyl)alumanylium;hydride;2-methylaniline has a molecular weight of 249.38 g/mol, XLogP of 4.53, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl)alumanylium;hydride;2-methylaniline is sourced from PubChem (CID 174831782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).