About 2-methylaniline;2-methylpropan-1-amine
2-methylaniline;2-methylpropan-1-amine (PubChem CID 22279170) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is 2-methylaniline;2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 2-methylaniline;2-methylpropan-1-amine |
| PubChem CID | 22279170 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-methylaniline;2-methylpropan-1-amine |
| SMILES | CC(C)CN.Cc1ccccc1N |
| InChI | InChI=1S/C7H9N.C4H11N/c1-6-4-2-3-5-7(6)8;1-4(2)3-5/h2-5H,8H2,1H3;4H,3,5H2,1-2H3 |
| InChIKey | WWSYORVEOIAKSA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylaniline;2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylaniline;2-methylpropan-1-amine?
The IUPAC name of 2-methylaniline;2-methylpropan-1-amine (CID 22279170) is 2-methylaniline;2-methylpropan-1-amine.
What is the SMILES notation for 2-methylaniline;2-methylpropan-1-amine?
The canonical SMILES for 2-methylaniline;2-methylpropan-1-amine is CC(C)CN.Cc1ccccc1N.
What is the InChIKey of 2-methylaniline;2-methylpropan-1-amine?
The InChIKey is WWSYORVEOIAKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C4H11N/c1-6-4-2-3-5-7(6)8;1-4(2)3-5/h2-5H,8H2,1H3;4H,3,5H2,1-2H3.
What are the key properties of 2-methylaniline;2-methylpropan-1-amine?
2-methylaniline;2-methylpropan-1-amine has a molecular weight of 180.30 g/mol, XLogP of 2.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylaniline;2-methylpropan-1-amine is sourced from PubChem (CID 22279170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).