C34H44N2O5 — CID 174834050
2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;2-hexyl-3-(2-hydroxybenzoyl)benzoic acid (PubChem CID 174834050) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;2-hexyl-3-(2-hydroxybenzoyl)benzoic acid.
| Compound Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;2-hexyl-3-(2-hydroxybenzoyl)benzoic acid |
|---|---|
| PubChem CID | 174834050 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;2-hexyl-3-(2-hydroxybenzoyl)benzoic acid |
| SMILES | CCCCCCc1c(C(=O)O)cccc1C(=O)c1ccccc1O.CCN(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C20H22O4.C14H22N2O/c1-2-3-4-5-9-14-15(11-8-12-16(14)20(23)24)19(22)17-10-6-7-13-18(17)21;1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h6-8,10-13,21H,2-5,9H2,1H3,(H,23,24);7-9H,5-6,10H2,1-4H3,(H,15,17) |
| InChIKey | IHWZDAVLPBOGEX-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|